C17H13ClFN3O3 — CID 87336603
[2-[(6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carbonyl)amino]-6-fluorophenyl] propanoate (PubChem CID 87336603) has the molecular formula C17H13ClFN3O3 and a molecular weight of 361.76 g/mol. Its IUPAC name is [2-[(6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carbonyl)amino]-6-fluorophenyl] propanoate.
| Compound Name | [2-[(6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carbonyl)amino]-6-fluorophenyl] propanoate |
|---|---|
| PubChem CID | 87336603 |
| Molecular Formula | C17H13ClFN3O3 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | [2-[(6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carbonyl)amino]-6-fluorophenyl] propanoate |
| SMILES | CCC(=O)Oc1c(F)cccc1NC(=O)c1cc2ccc(Cl)nc2[nH]1 |
| InChI | InChI=1S/C17H13ClFN3O3/c1-2-14(23)25-15-10(19)4-3-5-11(15)21-17(24)12-8-9-6-7-13(18)22-16(9)20-12/h3-8H,2H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | WVEYFTZWUQLSHP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|