C15H11F2N3O — CID 63118402
5-amino-N-(2,3-difluorophenyl)-1H-indole-2-carboxamide (PubChem CID 63118402) has the molecular formula C15H11F2N3O and a molecular weight of 287.27 g/mol. Its IUPAC name is 5-amino-N-(2,3-difluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | 5-amino-N-(2,3-difluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 63118402 |
| Molecular Formula | C15H11F2N3O |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-amino-N-(2,3-difluorophenyl)-1H-indole-2-carboxamide |
| SMILES | Nc1ccc2[nH]c(C(=O)Nc3cccc(F)c3F)cc2c1 |
| InChI | InChI=1S/C15H11F2N3O/c16-10-2-1-3-12(14(10)17)20-15(21)13-7-8-6-9(18)4-5-11(8)19-13/h1-7,19H,18H2,(H,20,21) |
| InChIKey | FSHXVYXHNVNYSO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|