C11H19N3O — CID 174675662
benzene-1,2,3-triamine;pentan-3-one (PubChem CID 174675662) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is benzene-1,2,3-triamine;pentan-3-one.
| Compound Name | benzene-1,2,3-triamine;pentan-3-one |
|---|---|
| PubChem CID | 174675662 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | benzene-1,2,3-triamine;pentan-3-one |
| SMILES | CCC(=O)CC.Nc1cccc(N)c1N |
| InChI | InChI=1S/C6H9N3.C5H10O/c7-4-2-1-3-5(8)6(4)9;1-3-5(6)4-2/h1-3H,7-9H2;3-4H2,1-2H3 |
| InChIKey | FTWUWFNKCNQXCA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|