C9H12N2O — CID 14773132
1-(2,3-diaminophenyl)propan-1-one (PubChem CID 14773132) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-(2,3-diaminophenyl)propan-1-one.
| Compound Name | 1-(2,3-diaminophenyl)propan-1-one |
|---|---|
| PubChem CID | 14773132 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-(2,3-diaminophenyl)propan-1-one |
| SMILES | CCC(=O)c1cccc(N)c1N |
| InChI | InChI=1S/C9H12N2O/c1-2-8(12)6-4-3-5-7(10)9(6)11/h3-5H,2,10-11H2,1H3 |
| InChIKey | YBENTUSJCTZMSM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|