amino 2,3-diaminobenzoate

C7H9N3O2 — CID 66872276

IUPACamino 2,3-diaminobenzoate
SMILESNOC(=O)c1cccc(N)c1N
InChIInChI=1S/C7H9N3O2/c8-5-3-1-2-4(6(5)9)7(11)12-10/h1-3H,8-10H2
InChIKeySMXAWAJOSVYFPU-UHFFFAOYSA-N
MW167.17 g/mol
LogP-0.12
Rot. Bonds1

About amino 2,3-diaminobenzoate

amino 2,3-diaminobenzoate (PubChem CID 66872276) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is amino 2,3-diaminobenzoate.

Molecular Properties

Compound Nameamino 2,3-diaminobenzoate
PubChem CID66872276
Molecular FormulaC7H9N3O2
Molecular Weight167.17 g/mol
Exact Mass167.07
IUPAC Nameamino 2,3-diaminobenzoate
SMILESNOC(=O)c1cccc(N)c1N
InChIInChI=1S/C7H9N3O2/c8-5-3-1-2-4(6(5)9)7(11)12-10/h1-3H,8-10H2
InChIKeySMXAWAJOSVYFPU-UHFFFAOYSA-N
XLogP-0.12
TPSA104.36 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.17
LogP ≤ 5-0.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 2,3-diaminobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 2,3-diaminobenzoate?
The IUPAC name of amino 2,3-diaminobenzoate (CID 66872276) is amino 2,3-diaminobenzoate.
What is the SMILES notation for amino 2,3-diaminobenzoate?
The canonical SMILES for amino 2,3-diaminobenzoate is NOC(=O)c1cccc(N)c1N.
What is the InChIKey of amino 2,3-diaminobenzoate?
The InChIKey is SMXAWAJOSVYFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c8-5-3-1-2-4(6(5)9)7(11)12-10/h1-3H,8-10H2.
What are the key properties of amino 2,3-diaminobenzoate?
amino 2,3-diaminobenzoate has a molecular weight of 167.17 g/mol, XLogP of -0.12, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2,3-diaminobenzoate is sourced from PubChem (CID 66872276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).