About amino 2,3-diaminobenzoate
amino 2,3-diaminobenzoate (PubChem CID 66872276) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is amino 2,3-diaminobenzoate.
Molecular Properties
| Compound Name | amino 2,3-diaminobenzoate |
| PubChem CID | 66872276 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | amino 2,3-diaminobenzoate |
| SMILES | NOC(=O)c1cccc(N)c1N |
| InChI | InChI=1S/C7H9N3O2/c8-5-3-1-2-4(6(5)9)7(11)12-10/h1-3H,8-10H2 |
| InChIKey | SMXAWAJOSVYFPU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 2,3-diaminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 2,3-diaminobenzoate?
The IUPAC name of amino 2,3-diaminobenzoate (CID 66872276) is amino 2,3-diaminobenzoate.
What is the SMILES notation for amino 2,3-diaminobenzoate?
The canonical SMILES for amino 2,3-diaminobenzoate is NOC(=O)c1cccc(N)c1N.
What is the InChIKey of amino 2,3-diaminobenzoate?
The InChIKey is SMXAWAJOSVYFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c8-5-3-1-2-4(6(5)9)7(11)12-10/h1-3H,8-10H2.
What are the key properties of amino 2,3-diaminobenzoate?
amino 2,3-diaminobenzoate has a molecular weight of 167.17 g/mol, XLogP of -0.12, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2,3-diaminobenzoate is sourced from PubChem (CID 66872276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).