C17H31N5O — CID 70385195
2,3-diamino-N,N-bis(4-amino-2-methylbutan-2-yl)benzamide (PubChem CID 70385195) has the molecular formula C17H31N5O and a molecular weight of 321.47 g/mol. Its IUPAC name is 2,3-diamino-N,N-bis(4-amino-2-methylbutan-2-yl)benzamide.
| Compound Name | 2,3-diamino-N,N-bis(4-amino-2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 70385195 |
| Molecular Formula | C17H31N5O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 2,3-diamino-N,N-bis(4-amino-2-methylbutan-2-yl)benzamide |
| SMILES | CC(C)(CCN)N(C(=O)c1cccc(N)c1N)C(C)(C)CCN |
| InChI | InChI=1S/C17H31N5O/c1-16(2,8-10-18)22(17(3,4)9-11-19)15(23)12-6-5-7-13(20)14(12)21/h5-7H,8-11,18-21H2,1-4H3 |
| InChIKey | UPGKBLPIUXWMIH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|