C16H30N2O — CID 178163170
1-(2-aminophenyl)ethanone;3,3-dimethylbutan-1-amine;ethane (PubChem CID 178163170) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-(2-aminophenyl)ethanone;3,3-dimethylbutan-1-amine;ethane.
| Compound Name | 1-(2-aminophenyl)ethanone;3,3-dimethylbutan-1-amine;ethane |
|---|---|
| PubChem CID | 178163170 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-(2-aminophenyl)ethanone;3,3-dimethylbutan-1-amine;ethane |
| SMILES | CC.CC(=O)c1ccccc1N.CC(C)(C)CCN |
| InChI | InChI=1S/C8H9NO.C6H15N.C2H6/c1-6(10)7-4-2-3-5-8(7)9;1-6(2,3)4-5-7;1-2/h2-5H,9H2,1H3;4-5,7H2,1-3H3;1-2H3 |
| InChIKey | BRPNMRJOVJJGSS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|