C8H10N2O2 — CID 122504845
1-(2,4-diaminophenoxy)ethenol (PubChem CID 122504845) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-(2,4-diaminophenoxy)ethenol.
| Compound Name | 1-(2,4-diaminophenoxy)ethenol |
|---|---|
| PubChem CID | 122504845 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-(2,4-diaminophenoxy)ethenol |
| SMILES | C=C(O)Oc1ccc(N)cc1N |
| InChI | InChI=1S/C8H10N2O2/c1-5(11)12-8-3-2-6(9)4-7(8)10/h2-4,11H,1,9-10H2 |
| InChIKey | KWXRNMIMJNBVFW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|