C6H10N2O6S — CID 174943515
4-hydroperoxybenzene-1,3-diamine;sulfuric acid (PubChem CID 174943515) has the molecular formula C6H10N2O6S and a molecular weight of 238.22 g/mol. Its IUPAC name is 4-hydroperoxybenzene-1,3-diamine;sulfuric acid.
| Compound Name | 4-hydroperoxybenzene-1,3-diamine;sulfuric acid |
|---|---|
| PubChem CID | 174943515 |
| Molecular Formula | C6H10N2O6S |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 4-hydroperoxybenzene-1,3-diamine;sulfuric acid |
| SMILES | Nc1ccc(OO)c(N)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C6H8N2O2.H2O4S/c7-4-1-2-6(10-9)5(8)3-4;1-5(2,3)4/h1-3,9H,7-8H2;(H2,1,2,3,4) |
| InChIKey | DQIMIOQBYNRBCS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|