C8H12N2O5S — CID 87689925
2-(2,5-diaminophenyl)acetaldehyde;sulfuric acid (PubChem CID 87689925) has the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-(2,5-diaminophenyl)acetaldehyde;sulfuric acid.
| Compound Name | 2-(2,5-diaminophenyl)acetaldehyde;sulfuric acid |
|---|---|
| PubChem CID | 87689925 |
| Molecular Formula | C8H12N2O5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(2,5-diaminophenyl)acetaldehyde;sulfuric acid |
| SMILES | Nc1ccc(N)c(CC=O)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H10N2O.H2O4S/c9-7-1-2-8(10)6(5-7)3-4-11;1-5(2,3)4/h1-2,4-5H,3,9-10H2;(H2,1,2,3,4) |
| InChIKey | PZOVLBGOSFSXRK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|