C19H23BrClN3 — CID 126674142
N'-[2-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]phenyl]methylamino]ethyl]ethane-1,2-diamine (PubChem CID 126674142) has the molecular formula C19H23BrClN3 and a molecular weight of 408.77 g/mol. Its IUPAC name is N'-[2-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]phenyl]methylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]phenyl]methylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 126674142 |
| Molecular Formula | C19H23BrClN3 |
| Molecular Weight | 408.77 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N'-[2-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]phenyl]methylamino]ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCNCc1cccc(/C=C/c2ccc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C19H23BrClN3/c20-19-13-18(21)7-6-17(19)5-4-15-2-1-3-16(12-15)14-24-11-10-23-9-8-22/h1-7,12-13,23-24H,8-11,14,22H2/b5-4+ |
| InChIKey | TWHOCIFIAAMORX-SNAWJCMRSA-N |
| XLogP | 3.91 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|