C18H22BrCl2N3O — CID 145271664
N'-[2-[[3-[(2-bromo-4-chlorophenyl)methoxy]-5-chlorophenyl]methylamino]ethyl]ethane-1,2-diamine (PubChem CID 145271664) has the molecular formula C18H22BrCl2N3O and a molecular weight of 447.20 g/mol. Its IUPAC name is N'-[2-[[3-[(2-bromo-4-chlorophenyl)methoxy]-5-chlorophenyl]methylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[[3-[(2-bromo-4-chlorophenyl)methoxy]-5-chlorophenyl]methylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 145271664 |
| Molecular Formula | C18H22BrCl2N3O |
| Molecular Weight | 447.20 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | N'-[2-[[3-[(2-bromo-4-chlorophenyl)methoxy]-5-chlorophenyl]methylamino]ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCNCc1cc(Cl)cc(OCc2ccc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C18H22BrCl2N3O/c19-18-10-15(20)2-1-14(18)12-25-17-8-13(7-16(21)9-17)11-24-6-5-23-4-3-22/h1-2,7-10,23-24H,3-6,11-12,22H2 |
| InChIKey | IFQBRIOUAHYRMI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|