C9H12BrClN2 — CID 107938708
N'-[(3-bromo-5-chlorophenyl)methyl]ethane-1,2-diamine (PubChem CID 107938708) has the molecular formula C9H12BrClN2 and a molecular weight of 263.57 g/mol. Its IUPAC name is N'-[(3-bromo-5-chlorophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(3-bromo-5-chlorophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107938708 |
| Molecular Formula | C9H12BrClN2 |
| Molecular Weight | 263.57 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | N'-[(3-bromo-5-chlorophenyl)methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C9H12BrClN2/c10-8-3-7(4-9(11)5-8)6-13-2-1-12/h3-5,13H,1-2,6,12H2 |
| InChIKey | OZELEZNQEZDYLQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|