C12H17Cl2NOS — CID 103649025
3-[2-[(3,5-dichlorophenyl)methylamino]ethylsulfanyl]propan-1-ol (PubChem CID 103649025) has the molecular formula C12H17Cl2NOS and a molecular weight of 294.25 g/mol. Its IUPAC name is 3-[2-[(3,5-dichlorophenyl)methylamino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(3,5-dichlorophenyl)methylamino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 103649025 |
| Molecular Formula | C12H17Cl2NOS |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-[2-[(3,5-dichlorophenyl)methylamino]ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NOS/c13-11-6-10(7-12(14)8-11)9-15-2-5-17-4-1-3-16/h6-8,15-16H,1-5,9H2 |
| InChIKey | QFVSFYKZRSQDRY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|