C12H17ClN2O2S — CID 114171675
3-amino-5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide (PubChem CID 114171675) has the molecular formula C12H17ClN2O2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 3-amino-5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide.
| Compound Name | 3-amino-5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 114171675 |
| Molecular Formula | C12H17ClN2O2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-amino-5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide |
| SMILES | Nc1cc(Cl)cc(C(=O)NCCSCCCO)c1 |
| InChI | InChI=1S/C12H17ClN2O2S/c13-10-6-9(7-11(14)8-10)12(17)15-2-5-18-4-1-3-16/h6-8,16H,1-5,14H2,(H,15,17) |
| InChIKey | NPBUUVVTPNVJAB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|