C11H16N2O2S — CID 139903951
3-amino-N-[2-(2-hydroxyethylsulfanyl)ethyl]benzamide (PubChem CID 139903951) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-amino-N-[2-(2-hydroxyethylsulfanyl)ethyl]benzamide.
| Compound Name | 3-amino-N-[2-(2-hydroxyethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 139903951 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-amino-N-[2-(2-hydroxyethylsulfanyl)ethyl]benzamide |
| SMILES | Nc1cccc(C(=O)NCCSCCO)c1 |
| InChI | InChI=1S/C11H16N2O2S/c12-10-3-1-2-9(8-10)11(15)13-4-6-16-7-5-14/h1-3,8,14H,4-7,12H2,(H,13,15) |
| InChIKey | KMOWTKGEZHMFFX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|