C39H48N6 — CID 77385825
N'-[[4-[2-[3,5-bis[2-[4-[(2-aminoethylamino)methyl]phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl]ethane-1,2-diamine (PubChem CID 77385825) has the molecular formula C39H48N6 and a molecular weight of 600.86 g/mol. Its IUPAC name is N'-[[4-[2-[3,5-bis[2-[4-[(2-aminoethylamino)methyl]phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[4-[2-[3,5-bis[2-[4-[(2-aminoethylamino)methyl]phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 77385825 |
| Molecular Formula | C39H48N6 |
| Molecular Weight | 600.86 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | N'-[[4-[2-[3,5-bis[2-[4-[(2-aminoethylamino)methyl]phenyl]ethenyl]phenyl]ethenyl]phenyl]methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1ccc(C=Cc2cc(C=Cc3ccc(CNCCN)cc3)cc(C=Cc3ccc(CNCCN)cc3)c2)cc1 |
| InChI | InChI=1S/C39H48N6/c40-19-22-43-28-34-10-1-31(2-11-34)7-16-37-25-38(17-8-32-3-12-35(13-4-32)29-44-23-20-41)27-39(26-37)18-9-33-5-14-36(15-6-33)30-45-24-21-42/h1-18,25-27,43-45H,19-24,28-30,40-42H2 |
| InChIKey | LDYSXVWMGKOCCW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.86 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|