C21H42N2 — CID 143170155
(E)-but-2-ene;ethane;N-[(3-ethylphenyl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 143170155) has the molecular formula C21H42N2 and a molecular weight of 322.58 g/mol. Its IUPAC name is (E)-but-2-ene;ethane;N-[(3-ethylphenyl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | (E)-but-2-ene;ethane;N-[(3-ethylphenyl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143170155 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | (E)-but-2-ene;ethane;N-[(3-ethylphenyl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | C/C=C/C.CC.CC.CCc1cccc(CNCCN(C)C)c1 |
| InChI | InChI=1S/C13H22N2.C4H8.2C2H6/c1-4-12-6-5-7-13(10-12)11-14-8-9-15(2)3;1-3-4-2;2*1-2/h5-7,10,14H,4,8-9,11H2,1-3H3;3-4H,1-2H3;2*1-2H3/b;4-3+;; |
| InChIKey | VUAVBIVICGDJTA-NXZCPFRHSA-N |
| XLogP | 5.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|