C15H25N2 — CID 140622426
CID 140622426 (PubChem CID 140622426) has the molecular formula C15H25N2 and a molecular weight of 233.38 g/mol.
| Compound Name | CID 140622426 |
|---|---|
| PubChem CID | 140622426 |
| Molecular Formula | C15H25N2 |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | — |
| SMILES | [CH2]C(C)(C)c1cccc(CNCCN(C)C)c1 |
| InChI | InChI=1S/C15H25N2/c1-15(2,3)14-8-6-7-13(11-14)12-16-9-10-17(4)5/h6-8,11,16H,1,9-10,12H2,2-5H3 |
| InChIKey | OYSPOEBYHINULO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|