C12H19N — CID 68500116
2-(3-ethylphenyl)-N,N-dimethylethanamine (PubChem CID 68500116) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-(3-ethylphenyl)-N,N-dimethylethanamine.
| Compound Name | 2-(3-ethylphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 68500116 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-(3-ethylphenyl)-N,N-dimethylethanamine |
| SMILES | CCc1cccc(CCN(C)C)c1 |
| InChI | InChI=1S/C12H19N/c1-4-11-6-5-7-12(10-11)8-9-13(2)3/h5-7,10H,4,8-9H2,1-3H3 |
| InChIKey | GFYDXFXSAZPGIL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |