C10H14N2O — CID 143527748
N,N-dimethyl-2-(3-nitrosophenyl)ethanamine (PubChem CID 143527748) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-nitrosophenyl)ethanamine.
| Compound Name | N,N-dimethyl-2-(3-nitrosophenyl)ethanamine |
|---|---|
| PubChem CID | 143527748 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N,N-dimethyl-2-(3-nitrosophenyl)ethanamine |
| SMILES | CN(C)CCc1cccc(N=O)c1 |
| InChI | InChI=1S/C10H14N2O/c1-12(2)7-6-9-4-3-5-10(8-9)11-13/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | BSDICWNLVSUHOO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |