C10H15N3O — CID 89305977
N',N'-dimethyl-N-(3-nitrosophenyl)ethane-1,2-diamine (PubChem CID 89305977) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N',N'-dimethyl-N-(3-nitrosophenyl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(3-nitrosophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 89305977 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N',N'-dimethyl-N-(3-nitrosophenyl)ethane-1,2-diamine |
| SMILES | CN(C)CCNc1cccc(N=O)c1 |
| InChI | InChI=1S/C10H15N3O/c1-13(2)7-6-11-9-4-3-5-10(8-9)12-14/h3-5,8,11H,6-7H2,1-2H3 |
| InChIKey | IJSMUSWUULUVBV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |