C11H17ClN2 — CID 65023741
N-[3-(chloromethyl)phenyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 65023741) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is N-[3-(chloromethyl)phenyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[3-(chloromethyl)phenyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 65023741 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-[3-(chloromethyl)phenyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1cccc(CCl)c1 |
| InChI | InChI=1S/C11H17ClN2/c1-14(2)7-6-13-11-5-3-4-10(8-11)9-12/h3-5,8,13H,6-7,9H2,1-2H3 |
| InChIKey | VLTASSGNUOBXIB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|