C10H18N3O2S- — CID 20978129
CID 20978129 (PubChem CID 20978129) has the molecular formula C10H18N3O2S- and a molecular weight of 244.34 g/mol.
| Compound Name | CID 20978129 |
|---|---|
| PubChem CID | 20978129 |
| Molecular Formula | C10H18N3O2S- |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | — |
| SMILES | CN(C)CCNc1ccccc1.NS(=O)[O-] |
| InChI | InChI=1S/C10H16N2.H3NO2S/c1-12(2)9-8-11-10-6-4-3-5-7-10;1-4(2)3/h3-7,11H,8-9H2,1-2H3;1H2,(H,2,3)/p-1 |
| InChIKey | PTALSVYJXYHQNS-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|