C13H18BrClN2O — CID 81495089
2-[(2-bromo-4-chlorophenyl)methylamino]-N-propylpropanamide (PubChem CID 81495089) has the molecular formula C13H18BrClN2O and a molecular weight of 333.66 g/mol. Its IUPAC name is 2-[(2-bromo-4-chlorophenyl)methylamino]-N-propylpropanamide.
| Compound Name | 2-[(2-bromo-4-chlorophenyl)methylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 81495089 |
| Molecular Formula | C13H18BrClN2O |
| Molecular Weight | 333.66 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-[(2-bromo-4-chlorophenyl)methylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NCc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H18BrClN2O/c1-3-6-16-13(18)9(2)17-8-10-4-5-11(15)7-12(10)14/h4-5,7,9,17H,3,6,8H2,1-2H3,(H,16,18) |
| InChIKey | MIINZWVAINTYGC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |