C13H20ClNO — CID 104854106
N-[(4-chloro-2-methylphenyl)methyl]-4-methoxybutan-2-amine (PubChem CID 104854106) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is N-[(4-chloro-2-methylphenyl)methyl]-4-methoxybutan-2-amine.
| Compound Name | N-[(4-chloro-2-methylphenyl)methyl]-4-methoxybutan-2-amine |
|---|---|
| PubChem CID | 104854106 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-[(4-chloro-2-methylphenyl)methyl]-4-methoxybutan-2-amine |
| SMILES | COCCC(C)NCc1ccc(Cl)cc1C |
| InChI | InChI=1S/C13H20ClNO/c1-10-8-13(14)5-4-12(10)9-15-11(2)6-7-16-3/h4-5,8,11,15H,6-7,9H2,1-3H3 |
| InChIKey | AFYOJHGMSXAJPL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |