C14H19BrClN — CID 107416853
N-[(2-bromo-5-chlorophenyl)methyl]-1-(2-methylcyclopentyl)methanamine (PubChem CID 107416853) has the molecular formula C14H19BrClN and a molecular weight of 316.67 g/mol. Its IUPAC name is N-[(2-bromo-5-chlorophenyl)methyl]-1-(2-methylcyclopentyl)methanamine.
| Compound Name | N-[(2-bromo-5-chlorophenyl)methyl]-1-(2-methylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 107416853 |
| Molecular Formula | C14H19BrClN |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[(2-bromo-5-chlorophenyl)methyl]-1-(2-methylcyclopentyl)methanamine |
| SMILES | CC1CCCC1CNCc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C14H19BrClN/c1-10-3-2-4-11(10)8-17-9-12-7-13(16)5-6-14(12)15/h5-7,10-11,17H,2-4,8-9H2,1H3 |
| InChIKey | PPRUTMDLNPAQEO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |