C15H19BrClNO2 — CID 66156894
2-[[(2-bromo-5-chlorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 66156894) has the molecular formula C15H19BrClNO2 and a molecular weight of 360.68 g/mol. Its IUPAC name is 2-[[(2-bromo-5-chlorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[(2-bromo-5-chlorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66156894 |
| Molecular Formula | C15H19BrClNO2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2-[[(2-bromo-5-chlorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1CNCc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C15H19BrClNO2/c16-14-6-5-12(17)7-11(14)9-18-8-10-3-1-2-4-13(10)15(19)20/h5-7,10,13,18H,1-4,8-9H2,(H,19,20) |
| InChIKey | ZNXJKOIQDPATJG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |