About N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine
N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine (PubChem CID 83235836) has the molecular formula C12H15Cl2NO
and a molecular weight of 260.16 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine.
Molecular Properties
| Compound Name | N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine |
| PubChem CID | 83235836 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine |
| SMILES | Clc1ccc(Cl)c(CNOC2CCCC2)c1 |
| InChI | InChI=1S/C12H15Cl2NO/c13-10-5-6-12(14)9(7-10)8-15-16-11-3-1-2-4-11/h5-7,11,15H,1-4,8H2 |
| InChIKey | ITVFWZARBDBCJX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine?
The IUPAC name of N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine (CID 83235836) is N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine.
What is the SMILES notation for N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine?
The canonical SMILES for N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine is Clc1ccc(Cl)c(CNOC2CCCC2)c1.
What is the InChIKey of N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine?
The InChIKey is ITVFWZARBDBCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO/c13-10-5-6-12(14)9(7-10)8-15-16-11-3-1-2-4-11/h5-7,11,15H,1-4,8H2.
What are the key properties of N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine?
N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine has a molecular weight of 260.16 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyloxy-1-(2,5-dichlorophenyl)methanamine is sourced from PubChem (CID 83235836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).