C11H18N4 — CID 97168885
cis-(1R,2S)-2-N-(pyrazin-2-ylmethyl)cyclohexane-1,2-diamine (PubChem CID 97168885) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is cis-(1R,2S)-2-N-(pyrazin-2-ylmethyl)cyclohexane-1,2-diamine.
| Compound Name | cis-(1R,2S)-2-N-(pyrazin-2-ylmethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 97168885 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | cis-(1R,2S)-2-N-(pyrazin-2-ylmethyl)cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@@H]1NCc1cnccn1 |
| InChI | InChI=1S/C11H18N4/c12-10-3-1-2-4-11(10)15-8-9-7-13-5-6-14-9/h5-7,10-11,15H,1-4,8,12H2/t10-,11+/m1/s1 |
| InChIKey | USLRCNKDBAAJRH-MNOVXSKESA-N |
| XLogP | 0.84 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |