C12H19N3OS — CID 112643346
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 112643346) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 112643346 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | NC(Cc1cncs1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C12H19N3OS/c13-11(4-10-5-14-8-17-10)12-6-15-3-1-2-9(15)7-16-12/h5,8-9,11-12H,1-4,6-7,13H2 |
| InChIKey | SRCQMIRBJJQJNH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |