C12H18N2OS — CID 110717473
N-[2-(1,3-thiazol-5-yl)ethyl]cyclohexanecarboxamide (PubChem CID 110717473) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-5-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(1,3-thiazol-5-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110717473 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-[2-(1,3-thiazol-5-yl)ethyl]cyclohexanecarboxamide |
| SMILES | O=C(NCCc1cncs1)C1CCCCC1 |
| InChI | InChI=1S/C12H18N2OS/c15-12(10-4-2-1-3-5-10)14-7-6-11-8-13-9-16-11/h8-10H,1-7H2,(H,14,15) |
| InChIKey | MJTUOLAYCHKJNQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |