C15H15NO3S — CID 64906632
1-(1,1-dioxothiolan-3-yl)-2-quinolin-2-ylethanone (PubChem CID 64906632) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-quinolin-2-ylethanone.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-quinolin-2-ylethanone |
|---|---|
| PubChem CID | 64906632 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-quinolin-2-ylethanone |
| SMILES | O=C(Cc1ccc2ccccc2n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H15NO3S/c17-15(12-7-8-20(18,19)10-12)9-13-6-5-11-3-1-2-4-14(11)16-13/h1-6,12H,7-10H2 |
| InChIKey | QCPFNACKFCFXEL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |