C11H11ClO4S — CID 16566374
(4-chlorophenyl) 1,1-dioxothiolane-3-carboxylate (PubChem CID 16566374) has the molecular formula C11H11ClO4S and a molecular weight of 274.72 g/mol. Its IUPAC name is (4-chlorophenyl) 1,1-dioxothiolane-3-carboxylate.
| Compound Name | (4-chlorophenyl) 1,1-dioxothiolane-3-carboxylate |
|---|---|
| PubChem CID | 16566374 |
| Molecular Formula | C11H11ClO4S |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (4-chlorophenyl) 1,1-dioxothiolane-3-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H11ClO4S/c12-9-1-3-10(4-2-9)16-11(13)8-5-6-17(14,15)7-8/h1-4,8H,5-7H2 |
| InChIKey | ZMWJRFRFEXRBIG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|