C17H16ClNO6S2 — CID 43038591
(4-chlorophenyl) 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate (PubChem CID 43038591) has the molecular formula C17H16ClNO6S2 and a molecular weight of 429.90 g/mol. Its IUPAC name is (4-chlorophenyl) 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate.
| Compound Name | (4-chlorophenyl) 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 43038591 |
| Molecular Formula | C17H16ClNO6S2 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (4-chlorophenyl) 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate |
| SMILES | O=C(Oc1ccc(Cl)cc1)c1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H16ClNO6S2/c18-13-3-5-15(6-4-13)25-17(20)12-1-7-16(8-2-12)27(23,24)19-14-9-10-26(21,22)11-14/h1-8,14,19H,9-11H2 |
| InChIKey | DEYDBHMJNMMPRP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|