C24H23N3O5S2 — CID 43036891
N-(benzhydrylideneamino)-4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide (PubChem CID 43036891) has the molecular formula C24H23N3O5S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-(benzhydrylideneamino)-4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide.
| Compound Name | N-(benzhydrylideneamino)-4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 43036891 |
| Molecular Formula | C24H23N3O5S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-(benzhydrylideneamino)-4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide |
| SMILES | O=C(NN=C(c1ccccc1)c1ccccc1)c1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C24H23N3O5S2/c28-24(26-25-23(18-7-3-1-4-8-18)19-9-5-2-6-10-19)20-11-13-22(14-12-20)34(31,32)27-21-15-16-33(29,30)17-21/h1-14,21,27H,15-17H2,(H,26,28) |
| InChIKey | NCCSVEZDDCPXBO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|