C13H15N5O5S2 — CID 42954274
4-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 42954274) has the molecular formula C13H15N5O5S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 42954274 |
| Molecular Formula | C13H15N5O5S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H15N5O5S2/c19-12(16-13-14-8-15-17-13)9-1-3-11(4-2-9)25(22,23)18-10-5-6-24(20,21)7-10/h1-4,8,10,18H,5-7H2,(H2,14,15,16,17,19) |
| InChIKey | PKFRYXGYSCMVGC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |