C11H10Cl2O4S — CID 86909284
(2,6-dichlorophenyl) 1,1-dioxothiolane-3-carboxylate (PubChem CID 86909284) has the molecular formula C11H10Cl2O4S and a molecular weight of 309.17 g/mol. Its IUPAC name is (2,6-dichlorophenyl) 1,1-dioxothiolane-3-carboxylate.
| Compound Name | (2,6-dichlorophenyl) 1,1-dioxothiolane-3-carboxylate |
|---|---|
| PubChem CID | 86909284 |
| Molecular Formula | C11H10Cl2O4S |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | (2,6-dichlorophenyl) 1,1-dioxothiolane-3-carboxylate |
| SMILES | O=C(Oc1c(Cl)cccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H10Cl2O4S/c12-8-2-1-3-9(13)10(8)17-11(14)7-4-5-18(15,16)6-7/h1-3,7H,4-6H2 |
| InChIKey | SBKJLYDOGSOHOQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|