C10H9BrN2O2S — CID 115184721
N-[(4-bromothiophen-2-yl)methyl]-3-cyanooxetane-3-carboxamide (PubChem CID 115184721) has the molecular formula C10H9BrN2O2S and a molecular weight of 301.17 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-3-cyanooxetane-3-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-3-cyanooxetane-3-carboxamide |
|---|---|
| PubChem CID | 115184721 |
| Molecular Formula | C10H9BrN2O2S |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-3-cyanooxetane-3-carboxamide |
| SMILES | N#CC1(C(=O)NCc2cc(Br)cs2)COC1 |
| InChI | InChI=1S/C10H9BrN2O2S/c11-7-1-8(16-3-7)2-13-9(14)10(4-12)5-15-6-10/h1,3H,2,5-6H2,(H,13,14) |
| InChIKey | WLIZQTAKDJXEAM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |