C13H12F2N2O2 — CID 115184813
3-cyano-N-[2-(3,4-difluorophenyl)ethyl]oxetane-3-carboxamide (PubChem CID 115184813) has the molecular formula C13H12F2N2O2 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-cyano-N-[2-(3,4-difluorophenyl)ethyl]oxetane-3-carboxamide.
| Compound Name | 3-cyano-N-[2-(3,4-difluorophenyl)ethyl]oxetane-3-carboxamide |
|---|---|
| PubChem CID | 115184813 |
| Molecular Formula | C13H12F2N2O2 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-cyano-N-[2-(3,4-difluorophenyl)ethyl]oxetane-3-carboxamide |
| SMILES | N#CC1(C(=O)NCCc2ccc(F)c(F)c2)COC1 |
| InChI | InChI=1S/C13H12F2N2O2/c14-10-2-1-9(5-11(10)15)3-4-17-12(18)13(6-16)7-19-8-13/h1-2,5H,3-4,7-8H2,(H,17,18) |
| InChIKey | PRAPOGJDZSIJJL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |