C15H13BrN2OS — CID 47250258
N-[(4-bromothiophen-2-yl)methyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 47250258) has the molecular formula C15H13BrN2OS and a molecular weight of 349.25 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 47250258 |
| Molecular Formula | C15H13BrN2OS |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C15H13BrN2OS/c16-11-6-12(20-9-11)8-18-15(19)5-10-7-17-14-4-2-1-3-13(10)14/h1-4,6-7,9,17H,5,8H2,(H,18,19) |
| InChIKey | WKQIOHSURQDKOO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |