C14H12BrNO2S2 — CID 107963936
5-bromo-N-[[5-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide (PubChem CID 107963936) has the molecular formula C14H12BrNO2S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 5-bromo-N-[[5-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[[5-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107963936 |
| Molecular Formula | C14H12BrNO2S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | 5-bromo-N-[[5-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCc1ccc(C#CCCO)s1)c1csc(Br)c1 |
| InChI | InChI=1S/C14H12BrNO2S2/c15-13-7-10(9-19-13)14(18)16-8-12-5-4-11(20-12)3-1-2-6-17/h4-5,7,9,17H,2,6,8H2,(H,16,18) |
| InChIKey | CQGONZRYGQBSOT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|