C14H11Br2NO2S2 — CID 107963929
2,5-dibromo-N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide (PubChem CID 107963929) has the molecular formula C14H11Br2NO2S2 and a molecular weight of 449.19 g/mol. Its IUPAC name is 2,5-dibromo-N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107963929 |
| Molecular Formula | C14H11Br2NO2S2 |
| Molecular Weight | 449.19 g/mol |
| Exact Mass | 446.86 |
| IUPAC Name | 2,5-dibromo-N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCc1cc(C#CCCO)cs1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C14H11Br2NO2S2/c15-12-6-11(13(16)21-12)14(19)17-7-10-5-9(8-20-10)3-1-2-4-18/h5-6,8,18H,2,4,7H2,(H,17,19) |
| InChIKey | KATBKGUZUQCGAG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|