C15H11Br2NO2S — CID 107963897
2,5-dibromo-N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]thiophene-3-carboxamide (PubChem CID 107963897) has the molecular formula C15H11Br2NO2S and a molecular weight of 429.13 g/mol. Its IUPAC name is 2,5-dibromo-N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107963897 |
| Molecular Formula | C15H11Br2NO2S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.89 |
| IUPAC Name | 2,5-dibromo-N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCc1cccc(C#CCO)c1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C15H11Br2NO2S/c16-13-8-12(14(17)21-13)15(20)18-9-11-4-1-3-10(7-11)5-2-6-19/h1,3-4,7-8,19H,6,9H2,(H,18,20) |
| InChIKey | VQVFQPRGQVBIAS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|