C13H11Br2N3O2S — CID 107965172
2,5-dibromo-N-[[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl]thiophene-3-carboxamide (PubChem CID 107965172) has the molecular formula C13H11Br2N3O2S and a molecular weight of 433.13 g/mol. Its IUPAC name is 2,5-dibromo-N-[[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107965172 |
| Molecular Formula | C13H11Br2N3O2S |
| Molecular Weight | 433.13 g/mol |
| Exact Mass | 430.89 |
| IUPAC Name | 2,5-dibromo-N-[[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl]thiophene-3-carboxamide |
| SMILES | N/C(=N/O)c1ccc(CNC(=O)c2cc(Br)sc2Br)cc1 |
| InChI | InChI=1S/C13H11Br2N3O2S/c14-10-5-9(11(15)21-10)13(19)17-6-7-1-3-8(4-2-7)12(16)18-20/h1-5,20H,6H2,(H2,16,18)(H,17,19) |
| InChIKey | JLJAWNDMSMJBPL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.13 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|