C16H22N2O2S — CID 79158728
N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-3-methylpiperidine-1-carboxamide (PubChem CID 79158728) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-3-methylpiperidine-1-carboxamide.
| Compound Name | N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79158728 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-3-methylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)NCc2cc(C#CCCO)cs2)C1 |
| InChI | InChI=1S/C16H22N2O2S/c1-13-5-4-7-18(11-13)16(20)17-10-15-9-14(12-21-15)6-2-3-8-19/h9,12-13,19H,3-5,7-8,10-11H2,1H3,(H,17,20) |
| InChIKey | DWQBGMWPZGYTCU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|