C9H18N2O — CID 89048200
N-ethyl-3-methylpiperidine-1-carboxamide (PubChem CID 89048200) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is N-ethyl-3-methylpiperidine-1-carboxamide.
| Compound Name | N-ethyl-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 89048200 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | N-ethyl-3-methylpiperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C9H18N2O/c1-3-10-9(12)11-6-4-5-8(2)7-11/h8H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | WCTLBSOOQKPYGI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |