C9H20ClN3O — CID 172646385
(3S)-N-ethyl-3-(methylamino)piperidine-1-carboxamide;hydrochloride (PubChem CID 172646385) has the molecular formula C9H20ClN3O and a molecular weight of 221.73 g/mol. Its IUPAC name is (3S)-N-ethyl-3-(methylamino)piperidine-1-carboxamide;hydrochloride.
| Compound Name | (3S)-N-ethyl-3-(methylamino)piperidine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172646385 |
| Molecular Formula | C9H20ClN3O |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | (3S)-N-ethyl-3-(methylamino)piperidine-1-carboxamide;hydrochloride |
| SMILES | CCNC(=O)N1CCC[C@H](NC)C1.Cl |
| InChI | InChI=1S/C9H19N3O.ClH/c1-3-11-9(13)12-6-4-5-8(7-12)10-2;/h8,10H,3-7H2,1-2H3,(H,11,13);1H/t8-;/m0./s1 |
| InChIKey | DNDRTABOCVPOAA-QRPNPIFTSA-N |
| XLogP | 0.82 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |