C14H11FN2O2S — CID 104639407
5-fluoro-N-[[3-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]pyridine-2-carboxamide (PubChem CID 104639407) has the molecular formula C14H11FN2O2S and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-fluoro-N-[[3-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]pyridine-2-carboxamide.
| Compound Name | 5-fluoro-N-[[3-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104639407 |
| Molecular Formula | C14H11FN2O2S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5-fluoro-N-[[3-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCc1sccc1C#CCO)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H11FN2O2S/c15-11-3-4-12(16-8-11)14(19)17-9-13-10(2-1-6-18)5-7-20-13/h3-5,7-8,18H,6,9H2,(H,17,19) |
| InChIKey | SSCYKFJEKCNLJQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|