C20H24N2O5S — CID 70603793
(2S)-2-benzamidopentanedioic acid;4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 70603793) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is (2S)-2-benzamidopentanedioic acid;4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | (2S)-2-benzamidopentanedioic acid;4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 70603793 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S)-2-benzamidopentanedioic acid;4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | NC1CCCc2sccc21.O=C(O)CC[C@H](NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H13NO5.C8H11NS/c14-10(15)7-6-9(12(17)18)13-11(16)8-4-2-1-3-5-8;9-7-2-1-3-8-6(7)4-5-10-8/h1-5,9H,6-7H2,(H,13,16)(H,14,15)(H,17,18);4-5,7H,1-3,9H2/t9-;/m0./s1 |
| InChIKey | HRQSSSRBOIUJNX-FVGYRXGTSA-N |
| XLogP | 2.82 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |